C12H19IN2O4S — CID 3562605
N-[2-[bis(2-hydroxyethyl)amino]ethyl]-4-iodobenzenesulfonamide (PubChem CID 3562605) has the molecular formula C12H19IN2O4S and a molecular weight of 414.27 g/mol. Its IUPAC name is N-[2-[bis(2-hydroxyethyl)amino]ethyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[2-[bis(2-hydroxyethyl)amino]ethyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 3562605 |
| Molecular Formula | C12H19IN2O4S |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | N-[2-[bis(2-hydroxyethyl)amino]ethyl]-4-iodobenzenesulfonamide |
| SMILES | O=S(=O)(NCCN(CCO)CCO)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H19IN2O4S/c13-11-1-3-12(4-2-11)20(18,19)14-5-6-15(7-9-16)8-10-17/h1-4,14,16-17H,5-10H2 |
| InChIKey | VDTYGJVSOAFQFQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|