C24H27Cl2N3O — CID 3564089
3-(2,3-dichlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-pyridin-2-ylethyl)urea (PubChem CID 3564089) has the molecular formula C24H27Cl2N3O and a molecular weight of 444.41 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-pyridin-2-ylethyl)urea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 3564089 |
| Molecular Formula | C24H27Cl2N3O |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-(2-pyridin-2-ylethyl)urea |
| SMILES | CC1(C)C2CC=C(CN(CCc3ccccn3)C(=O)Nc3cccc(Cl)c3Cl)C1C2 |
| InChI | InChI=1S/C24H27Cl2N3O/c1-24(2)17-10-9-16(19(24)14-17)15-29(13-11-18-6-3-4-12-27-18)23(30)28-21-8-5-7-20(25)22(21)26/h3-9,12,17,19H,10-11,13-15H2,1-2H3,(H,28,30) |
| InChIKey | VZHOBUAYFSYOPY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|