C18H15N3O8 — CID 35652155
[2-(4-nitroanilino)-2-oxoethyl] 2-(1,3-benzodioxole-5-carbonylamino)acetate (PubChem CID 35652155) has the molecular formula C18H15N3O8 and a molecular weight of 401.33 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 2-(1,3-benzodioxole-5-carbonylamino)acetate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(1,3-benzodioxole-5-carbonylamino)acetate |
|---|---|
| PubChem CID | 35652155 |
| Molecular Formula | C18H15N3O8 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(1,3-benzodioxole-5-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc2c(c1)OCO2)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N3O8/c22-16(20-12-2-4-13(5-3-12)21(25)26)9-27-17(23)8-19-18(24)11-1-6-14-15(7-11)29-10-28-14/h1-7H,8-10H2,(H,19,24)(H,20,22) |
| InChIKey | SRXYRTDFCHRSOH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|