C20H14F3N3O2S3 — CID 3567864
2-[[2-methoxy-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methylsulfanyl]-4-methyl-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 3567864) has the molecular formula C20H14F3N3O2S3 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methylsulfanyl]-4-methyl-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[[2-methoxy-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methylsulfanyl]-4-methyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3567864 |
| Molecular Formula | C20H14F3N3O2S3 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 2-[[2-methoxy-5-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl]methylsulfanyl]-4-methyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | COc1ccc(C=C2SC(=S)NC2=O)cc1CSc1nc(C(F)(F)F)cc(C)c1C#N |
| InChI | InChI=1S/C20H14F3N3O2S3/c1-10-5-16(20(21,22)23)25-18(13(10)8-24)30-9-12-6-11(3-4-14(12)28-2)7-15-17(27)26-19(29)31-15/h3-7H,9H2,1-2H3,(H,26,27,29) |
| InChIKey | MGAVMNPXNNXYLC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|