C29H25F3N4O3S2 — CID 19547297
2-[[2-methoxy-5-[(E)-[1-(3-methoxypropyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl]methylsulfanyl]-4-phenyl-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 19547297) has the molecular formula C29H25F3N4O3S2 and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(E)-[1-(3-methoxypropyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl]methylsulfanyl]-4-phenyl-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[[2-methoxy-5-[(E)-[1-(3-methoxypropyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl]methylsulfanyl]-4-phenyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19547297 |
| Molecular Formula | C29H25F3N4O3S2 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 2-[[2-methoxy-5-[(E)-[1-(3-methoxypropyl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenyl]methylsulfanyl]-4-phenyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | COCCCN1C(=O)/C(=C\c2ccc(OC)c(CSc3nc(C(F)(F)F)cc(-c4ccccc4)c3C#N)c2)NC1=S |
| InChI | InChI=1S/C29H25F3N4O3S2/c1-38-12-6-11-36-27(37)23(34-28(36)40)14-18-9-10-24(39-2)20(13-18)17-41-26-22(16-33)21(19-7-4-3-5-8-19)15-25(35-26)29(30,31)32/h3-5,7-10,13-15H,6,11-12,17H2,1-2H3,(H,34,40)/b23-14+ |
| InChIKey | GPKSPYNRRPECCC-OEAKJJBVSA-N |
| XLogP | 6.03 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|