C19H25N3O3 — CID 35714063
4-[(E)-3-[[2-(tert-butylamino)-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-cyclopropylbenzamide (PubChem CID 35714063) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[(E)-3-[[2-(tert-butylamino)-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[(E)-3-[[2-(tert-butylamino)-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 35714063 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[(E)-3-[[2-(tert-butylamino)-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-cyclopropylbenzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)/C=C/c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)22-17(24)12-20-16(23)11-6-13-4-7-14(8-5-13)18(25)21-15-9-10-15/h4-8,11,15H,9-10,12H2,1-3H3,(H,20,23)(H,21,25)(H,22,24)/b11-6+ |
| InChIKey | AOOSWHGLXUNUAK-IZZDOVSWSA-N |
| XLogP | 1.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|