C23H23ClN2O6S — CID 35742588
N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 35742588) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 35742588 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N-[3-[(4-chlorophenyl)sulfamoyl]phenyl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2cccc(S(=O)(=O)Nc3ccc(Cl)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23ClN2O6S/c1-30-20-11-15(12-21(31-2)23(20)32-3)13-22(27)25-18-5-4-6-19(14-18)33(28,29)26-17-9-7-16(24)8-10-17/h4-12,14,26H,13H2,1-3H3,(H,25,27) |
| InChIKey | UTEMQDHOZUGWBR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |