C23H23FN2O6S — CID 26698644
2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 26698644) has the molecular formula C23H23FN2O6S and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26698644 |
| Molecular Formula | C23H23FN2O6S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)sulfonylamino]phenyl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23FN2O6S/c1-30-20-13-18(14-21(31-2)23(20)32-3)25-22(27)12-15-4-8-17(9-5-15)26-33(28,29)19-10-6-16(24)7-11-19/h4-11,13-14,26H,12H2,1-3H3,(H,25,27) |
| InChIKey | MNFKPEHKHSONIX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |