C23H27N3O5S — CID 35744205
N-[3-(butylsulfamoyl)phenyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide (PubChem CID 35744205) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 35744205 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)c2ccccc2OCc2c(C)noc2C)c1 |
| InChI | InChI=1S/C23H27N3O5S/c1-4-5-13-24-32(28,29)19-10-8-9-18(14-19)25-23(27)20-11-6-7-12-22(20)30-15-21-16(2)26-31-17(21)3/h6-12,14,24H,4-5,13,15H2,1-3H3,(H,25,27) |
| InChIKey | JOVATULTRTZIFU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|