C15H14N2O5 — CID 3574714
ethyl 5-(4-methylphenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 3574714) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is ethyl 5-(4-methylphenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl 5-(4-methylphenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 3574714 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | ethyl 5-(4-methylphenyl)-4,6-dioxo-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)N(c3ccc(C)cc3)C(=O)C2ON1 |
| InChI | InChI=1S/C15H14N2O5/c1-3-21-15(20)11-10-12(22-16-11)14(19)17(13(10)18)9-6-4-8(2)5-7-9/h4-7,12,16H,3H2,1-2H3 |
| InChIKey | BATWMXTULJNHHI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|