C23H24N4O4 — CID 3575123
3-[2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 3575123) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3575123 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-[2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)Nc2ccccc2N1C(=O)CN1C(=O)NC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H24N4O4/c1-23(2)21(30)24-16-10-6-7-11-18(16)27(23)19(28)14-26-20(29)17(25-22(26)31)13-12-15-8-4-3-5-9-15/h3-11,17H,12-14H2,1-2H3,(H,24,30)(H,25,31) |
| InChIKey | XEFBWYKMZGWDSG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|