C18H16ClN3O3S — CID 35754570
1-(4-chlorophenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-4-nitroanilino]ethanone (PubChem CID 35754570) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-4-nitroanilino]ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-4-nitroanilino]ethanone |
|---|---|
| PubChem CID | 35754570 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-4-nitroanilino]ethanone |
| SMILES | O=C(CN(C1=NCCCS1)c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O3S/c19-14-4-2-13(3-5-14)17(23)12-21(18-20-10-1-11-26-18)15-6-8-16(9-7-15)22(24)25/h2-9H,1,10-12H2 |
| InChIKey | FZTBMSUJDBROMX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|