C18H17Br2N3O3S — CID 45136072
2-[4-bromo-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]-1-(3-nitrophenyl)ethanone;hydrobromide (PubChem CID 45136072) has the molecular formula C18H17Br2N3O3S and a molecular weight of 515.23 g/mol. Its IUPAC name is 2-[4-bromo-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]-1-(3-nitrophenyl)ethanone;hydrobromide.
| Compound Name | 2-[4-bromo-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]-1-(3-nitrophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 45136072 |
| Molecular Formula | C18H17Br2N3O3S |
| Molecular Weight | 515.23 g/mol |
| Exact Mass | 512.94 |
| IUPAC Name | 2-[4-bromo-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)anilino]-1-(3-nitrophenyl)ethanone;hydrobromide |
| SMILES | Br.O=C(CN(C1=NCCCS1)c1ccc(Br)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16BrN3O3S.BrH/c19-14-5-7-15(8-6-14)21(18-20-9-2-10-26-18)12-17(23)13-3-1-4-16(11-13)22(24)25;/h1,3-8,11H,2,9-10,12H2;1H |
| InChIKey | JPUJZEULKQFKMG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|