C20H20BrN3O3 — CID 4750932
2-[4-bromo-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]-1-(3-nitrophenyl)ethanone (PubChem CID 4750932) has the molecular formula C20H20BrN3O3 and a molecular weight of 430.30 g/mol. Its IUPAC name is 2-[4-bromo-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[4-bromo-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 4750932 |
| Molecular Formula | C20H20BrN3O3 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[4-bromo-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]-1-(3-nitrophenyl)ethanone |
| SMILES | O=C(CN(C1=NCCCCC1)c1ccc(Br)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20BrN3O3/c21-16-8-10-17(11-9-16)23(20-7-2-1-3-12-22-20)14-19(25)15-5-4-6-18(13-15)24(26)27/h4-6,8-11,13H,1-3,7,12,14H2 |
| InChIKey | FJPRJPDRMXEKQW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|