C21H24BrN3O3 — CID 45135874
1-(4-methylphenyl)-2-[3-nitro-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]ethanone;hydrobromide (PubChem CID 45135874) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[3-nitro-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]ethanone;hydrobromide.
| Compound Name | 1-(4-methylphenyl)-2-[3-nitro-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]ethanone;hydrobromide |
|---|---|
| PubChem CID | 45135874 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-(4-methylphenyl)-2-[3-nitro-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)anilino]ethanone;hydrobromide |
| SMILES | Br.Cc1ccc(C(=O)CN(C2=NCCCCC2)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H23N3O3.BrH/c1-16-9-11-17(12-10-16)20(25)15-23(21-8-3-2-4-13-22-21)18-6-5-7-19(14-18)24(26)27;/h5-7,9-12,14H,2-4,8,13,15H2,1H3;1H |
| InChIKey | ZSRMJIQAJXJEOT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|