C19H19N3O3 — CID 4751909
1-(3-nitrophenyl)-2-[N-(2,3,4,5-tetrahydropyridin-6-yl)anilino]ethanone (PubChem CID 4751909) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-[N-(2,3,4,5-tetrahydropyridin-6-yl)anilino]ethanone.
| Compound Name | 1-(3-nitrophenyl)-2-[N-(2,3,4,5-tetrahydropyridin-6-yl)anilino]ethanone |
|---|---|
| PubChem CID | 4751909 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-(3-nitrophenyl)-2-[N-(2,3,4,5-tetrahydropyridin-6-yl)anilino]ethanone |
| SMILES | O=C(CN(C1=NCCCC1)c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O3/c23-18(15-7-6-10-17(13-15)22(24)25)14-21(16-8-2-1-3-9-16)19-11-4-5-12-20-19/h1-3,6-10,13H,4-5,11-12,14H2 |
| InChIKey | IDKYYUDDDDMMPP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|