C19H23N5O3S — CID 35754647
N-(2,4-dimethoxyphenyl)-2-(3-propyl-4-pyrrol-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)acetamide (PubChem CID 35754647) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(3-propyl-4-pyrrol-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(3-propyl-4-pyrrol-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 35754647 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(3-propyl-4-pyrrol-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)acetamide |
| SMILES | CCCc1nn(CC(=O)Nc2ccc(OC)cc2OC)c(=S)n1-n1cccc1 |
| InChI | InChI=1S/C19H23N5O3S/c1-4-7-17-21-23(19(28)24(17)22-10-5-6-11-22)13-18(25)20-15-9-8-14(26-2)12-16(15)27-3/h5-6,8-12H,4,7,13H2,1-3H3,(H,20,25) |
| InChIKey | VWTABKQSCVIKES-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|