C12H17N5 — CID 35754974
[4-methyl-5-[2-(4-methylphenyl)ethyl]-1,2,4-triazol-3-yl]hydrazine (PubChem CID 35754974) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is [4-methyl-5-[2-(4-methylphenyl)ethyl]-1,2,4-triazol-3-yl]hydrazine.
| Compound Name | [4-methyl-5-[2-(4-methylphenyl)ethyl]-1,2,4-triazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 35754974 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | [4-methyl-5-[2-(4-methylphenyl)ethyl]-1,2,4-triazol-3-yl]hydrazine |
| SMILES | Cc1ccc(CCc2nnc(NN)n2C)cc1 |
| InChI | InChI=1S/C12H17N5/c1-9-3-5-10(6-4-9)7-8-11-15-16-12(14-13)17(11)2/h3-6H,7-8,13H2,1-2H3,(H,14,16) |
| InChIKey | CIPTVXHGJJQWPV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|