C14H16N2O3S — CID 3575785
propan-2-yl 3-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoate (PubChem CID 3575785) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is propan-2-yl 3-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoate.
| Compound Name | propan-2-yl 3-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 3575785 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | propan-2-yl 3-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(/N=C2\SCC(=O)N2C)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-9(2)19-13(18)10-5-4-6-11(7-10)15-14-16(3)12(17)8-20-14/h4-7,9H,8H2,1-3H3/b15-14- |
| InChIKey | KMEKPPWURJOVQZ-PFONDFGASA-N |
| XLogP | 2.44 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|