C27H21ClFN3O3S — CID 3576429
13-(3-chloro-4-fluorophenyl)-10-(2,3-dimethoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one (PubChem CID 3576429) has the molecular formula C27H21ClFN3O3S and a molecular weight of 522.00 g/mol. Its IUPAC name is 13-(3-chloro-4-fluorophenyl)-10-(2,3-dimethoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one.
| Compound Name | 13-(3-chloro-4-fluorophenyl)-10-(2,3-dimethoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
|---|---|
| PubChem CID | 3576429 |
| Molecular Formula | C27H21ClFN3O3S |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 13-(3-chloro-4-fluorophenyl)-10-(2,3-dimethoxyphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
| SMILES | COc1cccc(C2c3[nH]c4ccccc4c3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=S)N32)c1OC |
| InChI | InChI=1S/C27H21ClFN3O3S/c1-34-22-9-5-7-16(25(22)35-2)24-23-17(15-6-3-4-8-20(15)30-23)13-21-26(33)31(27(36)32(21)24)14-10-11-19(29)18(28)12-14/h3-12,21,24,30H,13H2,1-2H3 |
| InChIKey | RFVHQPPQLBITQA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|