C23H29N3O3S — CID 35770652
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-butyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 35770652) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-butyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-butyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 35770652 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-butyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CCCCN(C(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)c1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C23H29N3O3S/c1-3-4-12-25(23-24-18-10-9-15(2)14-19(18)30-23)20(27)11-13-26-21(28)16-7-5-6-8-17(16)22(26)29/h9-10,14,16-17H,3-8,11-13H2,1-2H3/t16-,17+ |
| InChIKey | COEMDNVTYYSCQA-CALCHBBNSA-N |
| XLogP | 4.30 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|