C17H14N2O2S — CID 3577201
7-benzyl-8-methylidene-5H-[1,3]dioxolo[4,5-g]quinazoline-6-thione (PubChem CID 3577201) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 7-benzyl-8-methylidene-5H-[1,3]dioxolo[4,5-g]quinazoline-6-thione.
| Compound Name | 7-benzyl-8-methylidene-5H-[1,3]dioxolo[4,5-g]quinazoline-6-thione |
|---|---|
| PubChem CID | 3577201 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 7-benzyl-8-methylidene-5H-[1,3]dioxolo[4,5-g]quinazoline-6-thione |
| SMILES | C=C1c2cc3c(cc2NC(=S)N1Cc1ccccc1)OCO3 |
| InChI | InChI=1S/C17H14N2O2S/c1-11-13-7-15-16(21-10-20-15)8-14(13)18-17(22)19(11)9-12-5-3-2-4-6-12/h2-8H,1,9-10H2,(H,18,22) |
| InChIKey | TYWJRVSGRQNHTN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|