C22H14F6N4O2S — CID 3577550
3-amino-2-[2-[3-[2,5-bis(trifluoromethyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile (PubChem CID 3577550) has the molecular formula C22H14F6N4O2S and a molecular weight of 512.44 g/mol. Its IUPAC name is 3-amino-2-[2-[3-[2,5-bis(trifluoromethyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile.
| Compound Name | 3-amino-2-[2-[3-[2,5-bis(trifluoromethyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 3577550 |
| Molecular Formula | C22H14F6N4O2S |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 3-amino-2-[2-[3-[2,5-bis(trifluoromethyl)phenyl]-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile |
| SMILES | CC(N)=C(C#N)C(=O)CSc1nc2ccccc2c(=O)n1-c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H14F6N4O2S/c1-11(30)14(9-29)18(33)10-35-20-31-16-5-3-2-4-13(16)19(34)32(20)17-8-12(21(23,24)25)6-7-15(17)22(26,27)28/h2-8H,10,30H2,1H3 |
| InChIKey | FFRNGOVNOUXNLH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|