C20H15FN4O2S — CID 98410966
(Z)-3-amino-2-[2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile (PubChem CID 98410966) has the molecular formula C20H15FN4O2S and a molecular weight of 394.43 g/mol. Its IUPAC name is (Z)-3-amino-2-[2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile.
| Compound Name | (Z)-3-amino-2-[2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 98410966 |
| Molecular Formula | C20H15FN4O2S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (Z)-3-amino-2-[2-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(\C#N)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN4O2S/c1-12(23)16(10-22)18(26)11-28-20-24-17-5-3-2-4-15(17)19(27)25(20)14-8-6-13(21)7-9-14/h2-9H,11,23H2,1H3/b16-12- |
| InChIKey | ROPMQKFLKZWCIV-VBKFSLOCSA-N |
| XLogP | 2.94 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|