C22H22N2O8 — CID 35792891
[5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate (PubChem CID 35792891) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate.
| Compound Name | [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
|---|---|
| PubChem CID | 35792891 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetate |
| SMILES | COc1cc(-c2nnc(COC(=O)Cc3ccc4c(c3)OCCO4)o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O8/c1-26-17-10-14(11-18(27-2)21(17)28-3)22-24-23-19(32-22)12-31-20(25)9-13-4-5-15-16(8-13)30-7-6-29-15/h4-5,8,10-11H,6-7,9,12H2,1-3H3 |
| InChIKey | GNVQLUUFXXAPLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |