C24H20N6O4S — CID 3581066
ethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(4-nitrophenyl)hydrazinylidene]acetate (PubChem CID 3581066) has the molecular formula C24H20N6O4S and a molecular weight of 488.53 g/mol. Its IUPAC name is ethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(4-nitrophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(4-nitrophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 3581066 |
| Molecular Formula | C24H20N6O4S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | ethyl 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(4-nitrophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)C(=NNc1ccc([N+](=O)[O-])cc1)Sc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H20N6O4S/c1-2-34-23(31)22(27-25-18-13-15-20(16-14-18)30(32)33)35-24-28-26-21(17-9-5-3-6-10-17)29(24)19-11-7-4-8-12-19/h3-16,25H,2H2,1H3 |
| InChIKey | WCDAPHGAQCARHK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|