C25H23N5O3S — CID 6506644
ethyl (2Z)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(3-methoxyphenyl)hydrazinylidene]acetate (PubChem CID 6506644) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(3-methoxyphenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(3-methoxyphenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 6506644 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | ethyl (2Z)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-2-[(3-methoxyphenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1cccc(OC)c1)Sc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H23N5O3S/c1-3-33-24(31)23(28-26-19-13-10-16-21(17-19)32-2)34-25-29-27-22(18-11-6-4-7-12-18)30(25)20-14-8-5-9-15-20/h4-17,26H,3H2,1-2H3/b28-23- |
| InChIKey | BBUCWOOZAHFGQT-NFFVHWSESA-N |
| XLogP | 5.02 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|