C24H18Cl3N5O2S — CID 6506707
ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 6506707) has the molecular formula C24H18Cl3N5O2S and a molecular weight of 546.87 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 6506707 |
| Molecular Formula | C24H18Cl3N5O2S |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(Cl)cc1)Sc1nnc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C24H18Cl3N5O2S/c1-2-34-23(33)22(30-28-17-11-8-15(25)9-12-17)35-24-31-29-21(19-13-10-16(26)14-20(19)27)32(24)18-6-4-3-5-7-18/h3-14,28H,2H2,1H3/b30-22- |
| InChIKey | ICFOUUKSSVNTSV-SWKFRHMKSA-N |
| XLogP | 6.98 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|