C24H19Cl2N5OS — CID 6506060
[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl] (1Z)-N-(3-methylanilino)-2-oxopropanimidothioate (PubChem CID 6506060) has the molecular formula C24H19Cl2N5OS and a molecular weight of 496.42 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl] (1Z)-N-(3-methylanilino)-2-oxopropanimidothioate.
| Compound Name | [5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl] (1Z)-N-(3-methylanilino)-2-oxopropanimidothioate |
|---|---|
| PubChem CID | 6506060 |
| Molecular Formula | C24H19Cl2N5OS |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl] (1Z)-N-(3-methylanilino)-2-oxopropanimidothioate |
| SMILES | CC(=O)/C(=N/Nc1cccc(C)c1)Sc1nnc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C24H19Cl2N5OS/c1-15-7-6-8-18(13-15)27-29-23(16(2)32)33-24-30-28-22(20-12-11-17(25)14-21(20)26)31(24)19-9-4-3-5-10-19/h3-14,27H,1-2H3/b29-23- |
| InChIKey | UXAZNYJFYAVYNV-FAJYDZGRSA-N |
| XLogP | 6.66 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|