C16H12Cl2N6OS — CID 6506626
(1-phenyltetrazol-5-yl) (1Z)-N-(2,4-dichloroanilino)-2-oxopropanimidothioate (PubChem CID 6506626) has the molecular formula C16H12Cl2N6OS and a molecular weight of 407.29 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl) (1Z)-N-(2,4-dichloroanilino)-2-oxopropanimidothioate.
| Compound Name | (1-phenyltetrazol-5-yl) (1Z)-N-(2,4-dichloroanilino)-2-oxopropanimidothioate |
|---|---|
| PubChem CID | 6506626 |
| Molecular Formula | C16H12Cl2N6OS |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | (1-phenyltetrazol-5-yl) (1Z)-N-(2,4-dichloroanilino)-2-oxopropanimidothioate |
| SMILES | CC(=O)/C(=N/Nc1ccc(Cl)cc1Cl)Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H12Cl2N6OS/c1-10(25)15(20-19-14-8-7-11(17)9-13(14)18)26-16-21-22-23-24(16)12-5-3-2-4-6-12/h2-9,19H,1H3/b20-15- |
| InChIKey | ZARGQEQSAVOLGP-HKWRFOASSA-N |
| XLogP | 4.08 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|