C15H12Cl2N6 — CID 2825686
2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline (PubChem CID 2825686) has the molecular formula C15H12Cl2N6 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline.
| Compound Name | 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 2825686 |
| Molecular Formula | C15H12Cl2N6 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2,4-dichloro-N-[2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline |
| SMILES | Clc1ccc(NN=CCc2nnnn2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N6/c16-11-6-7-14(13(17)10-11)19-18-9-8-15-20-21-22-23(15)12-4-2-1-3-5-12/h1-7,9-10,19H,8H2 |
| InChIKey | LSRLOAGJYRWDLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|