C15H11BrCl2N6 — CID 6265548
N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-3,4-dichloroaniline (PubChem CID 6265548) has the molecular formula C15H11BrCl2N6 and a molecular weight of 426.11 g/mol. Its IUPAC name is N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-3,4-dichloroaniline.
| Compound Name | N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-3,4-dichloroaniline |
|---|---|
| PubChem CID | 6265548 |
| Molecular Formula | C15H11BrCl2N6 |
| Molecular Weight | 426.11 g/mol |
| Exact Mass | 423.96 |
| IUPAC Name | N-[(Z)-2-[1-(4-bromophenyl)tetrazol-5-yl]ethylideneamino]-3,4-dichloroaniline |
| SMILES | Clc1ccc(N/N=C\Cc2nnnn2-c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C15H11BrCl2N6/c16-10-1-4-12(5-2-10)24-15(21-22-23-24)7-8-19-20-11-3-6-13(17)14(18)9-11/h1-6,8-9,20H,7H2/b19-8- |
| InChIKey | LZVASTGQHDWDFG-UWVJOHFNSA-N |
| XLogP | 4.37 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.11 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|