C16H14Cl2N6 — CID 6030953
2,4-dichloro-N-[(Z)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethylideneamino]aniline (PubChem CID 6030953) has the molecular formula C16H14Cl2N6 and a molecular weight of 361.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethylideneamino]aniline.
| Compound Name | 2,4-dichloro-N-[(Z)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 6030953 |
| Molecular Formula | C16H14Cl2N6 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-2-[1-(4-methylphenyl)tetrazol-5-yl]ethylideneamino]aniline |
| SMILES | Cc1ccc(-n2nnnc2C/C=N\Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2N6/c1-11-2-5-13(6-3-11)24-16(21-22-23-24)8-9-19-20-15-7-4-12(17)10-14(15)18/h2-7,9-10,20H,8H2,1H3/b19-9- |
| InChIKey | AKHIBKJPUYIXKN-OCKHKDLRSA-N |
| XLogP | 3.92 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|