C31H32ClN5O3S — CID 6370226
ethyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 6370226) has the molecular formula C31H32ClN5O3S and a molecular weight of 590.15 g/mol. Its IUPAC name is ethyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 6370226 |
| Molecular Formula | C31H32ClN5O3S |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | ethyl (2E)-2-[(4-chlorophenyl)hydrazinylidene]-2-[[5-[(4-cyclohexylphenoxy)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)/C(=N\Nc1ccc(Cl)cc1)Sc1nnc(COc2ccc(C3CCCCC3)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C31H32ClN5O3S/c1-2-39-30(38)29(35-33-25-17-15-24(32)16-18-25)41-31-36-34-28(37(31)26-11-7-4-8-12-26)21-40-27-19-13-23(14-20-27)22-9-5-3-6-10-22/h4,7-8,11-20,22,33H,2-3,5-6,9-10,21H2,1H3/b35-29+ |
| InChIKey | WXOBVVNSXCLVDZ-OZMGXUMRSA-N |
| XLogP | 7.63 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|