C31H34BrN5O2S — CID 102551632
1-cyclohexyl-4-methylbenzene;[5-(hydroxymethyl)-4-phenyl-1,2,4-triazol-3-yl] (1E)-N-(4-bromoanilino)-2-oxopropanimidothioate (PubChem CID 102551632) has the molecular formula C31H34BrN5O2S and a molecular weight of 620.62 g/mol. Its IUPAC name is 1-cyclohexyl-4-methylbenzene;[5-(hydroxymethyl)-4-phenyl-1,2,4-triazol-3-yl] (1E)-N-(4-bromoanilino)-2-oxopropanimidothioate.
| Compound Name | 1-cyclohexyl-4-methylbenzene;[5-(hydroxymethyl)-4-phenyl-1,2,4-triazol-3-yl] (1E)-N-(4-bromoanilino)-2-oxopropanimidothioate |
|---|---|
| PubChem CID | 102551632 |
| Molecular Formula | C31H34BrN5O2S |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | 1-cyclohexyl-4-methylbenzene;[5-(hydroxymethyl)-4-phenyl-1,2,4-triazol-3-yl] (1E)-N-(4-bromoanilino)-2-oxopropanimidothioate |
| SMILES | CC(=O)/C(=N\Nc1ccc(Br)cc1)Sc1nnc(CO)n1-c1ccccc1.Cc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H16BrN5O2S.C13H18/c1-12(26)17(22-20-14-9-7-13(19)8-10-14)27-18-23-21-16(11-25)24(18)15-5-3-2-4-6-15;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h2-10,20,25H,11H2,1H3;7-10,12H,2-6H2,1H3/b22-17+; |
| InChIKey | BJKLCNOZURYNOV-GDHRODDYSA-N |
| XLogP | 7.67 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|