C20H20BrN5O3S — CID 3360361
ethyl 2-[(4-bromophenyl)hydrazinylidene]-2-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 3360361) has the molecular formula C20H20BrN5O3S and a molecular weight of 490.38 g/mol. Its IUPAC name is ethyl 2-[(4-bromophenyl)hydrazinylidene]-2-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[(4-bromophenyl)hydrazinylidene]-2-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 3360361 |
| Molecular Formula | C20H20BrN5O3S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | ethyl 2-[(4-bromophenyl)hydrazinylidene]-2-[[5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)C(=NNc1ccc(Br)cc1)Sc1nnc(-c2ccc(OC)cc2)n1C |
| InChI | InChI=1S/C20H20BrN5O3S/c1-4-29-19(27)18(24-22-15-9-7-14(21)8-10-15)30-20-25-23-17(26(20)2)13-5-11-16(28-3)12-6-13/h5-12,22H,4H2,1-3H3 |
| InChIKey | QZUGLVBEQVDVPF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|