C19H19NO2S2 — CID 3582115
1-[1-benzothiophen-3-yl(thiophen-3-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 3582115) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[1-benzothiophen-3-yl(thiophen-3-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-3-yl(thiophen-3-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3582115 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[1-benzothiophen-3-yl(thiophen-3-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(c2ccsc2)c2csc3ccccc23)CC1 |
| InChI | InChI=1S/C19H19NO2S2/c21-19(22)13-5-8-20(9-6-13)18(14-7-10-23-11-14)16-12-24-17-4-2-1-3-15(16)17/h1-4,7,10-13,18H,5-6,8-9H2,(H,21,22) |
| InChIKey | SWILLLJMQFUULE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |