C14H12F2N2O2S — CID 3583091
N-(2,4-difluorophenyl)sulfonyl-N'-methylbenzenecarboximidamide (PubChem CID 3583091) has the molecular formula C14H12F2N2O2S and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)sulfonyl-N'-methylbenzenecarboximidamide.
| Compound Name | N-(2,4-difluorophenyl)sulfonyl-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 3583091 |
| Molecular Formula | C14H12F2N2O2S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(2,4-difluorophenyl)sulfonyl-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)c1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C14H12F2N2O2S/c1-17-14(10-5-3-2-4-6-10)18-21(19,20)13-8-7-11(15)9-12(13)16/h2-9H,1H3,(H,17,18) |
| InChIKey | LTXOJIUVEFQMDC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|