C24H23F2N3O2S — CID 6856315
N'-(2,4-difluorophenyl)sulfonyl-N-(4-piperidin-1-ylphenyl)benzenecarboximidamide (PubChem CID 6856315) has the molecular formula C24H23F2N3O2S and a molecular weight of 455.53 g/mol. Its IUPAC name is N'-(2,4-difluorophenyl)sulfonyl-N-(4-piperidin-1-ylphenyl)benzenecarboximidamide.
| Compound Name | N'-(2,4-difluorophenyl)sulfonyl-N-(4-piperidin-1-ylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 6856315 |
| Molecular Formula | C24H23F2N3O2S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N'-(2,4-difluorophenyl)sulfonyl-N-(4-piperidin-1-ylphenyl)benzenecarboximidamide |
| SMILES | O=S(=O)(/N=C(\Nc1ccc(N2CCCCC2)cc1)c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F2N3O2S/c25-19-9-14-23(22(26)17-19)32(30,31)28-24(18-7-3-1-4-8-18)27-20-10-12-21(13-11-20)29-15-5-2-6-16-29/h1,3-4,7-14,17H,2,5-6,15-16H2,(H,27,28) |
| InChIKey | QNDOSYNFLKEZAY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|