C27H21NO5 — CID 3583686
4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid (PubChem CID 3583686) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid.
| Compound Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid |
|---|---|
| PubChem CID | 3583686 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxo-3-quinolin-2-ylbut-3-enoic acid |
| SMILES | COc1cc(C=C(C(=O)C(=O)O)c2ccc3ccccc3n2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H21NO5/c1-32-25-16-19(11-14-24(25)33-17-18-7-3-2-4-8-18)15-21(26(29)27(30)31)23-13-12-20-9-5-6-10-22(20)28-23/h2-16H,17H2,1H3,(H,30,31) |
| InChIKey | VAGTUOOZPXMFLN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|