C20H15NO5S — CID 3583849
(2-oxo-2-thiophen-2-ylethyl) 2-[3-(furan-2-yl)prop-2-enoylamino]benzoate (PubChem CID 3583849) has the molecular formula C20H15NO5S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-[3-(furan-2-yl)prop-2-enoylamino]benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-[3-(furan-2-yl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 3583849 |
| Molecular Formula | C20H15NO5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-[3-(furan-2-yl)prop-2-enoylamino]benzoate |
| SMILES | O=C(C=Cc1ccco1)Nc1ccccc1C(=O)OCC(=O)c1cccs1 |
| InChI | InChI=1S/C20H15NO5S/c22-17(18-8-4-12-27-18)13-26-20(24)15-6-1-2-7-16(15)21-19(23)10-9-14-5-3-11-25-14/h1-12H,13H2,(H,21,23) |
| InChIKey | YJCHMBRRQYZLDQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|