C23H17N2O5- — CID 3584793
2-[2-(3,4-dimethoxyphenyl)benzimidazole-1-carbonyl]benzoate (PubChem CID 3584793) has the molecular formula C23H17N2O5- and a molecular weight of 401.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)benzimidazole-1-carbonyl]benzoate.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)benzimidazole-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 3584793 |
| Molecular Formula | C23H17N2O5- |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)benzimidazole-1-carbonyl]benzoate |
| SMILES | COc1ccc(-c2nc3ccccc3n2C(=O)c2ccccc2C(=O)[O-])cc1OC |
| InChI | InChI=1S/C23H18N2O5/c1-29-19-12-11-14(13-20(19)30-2)21-24-17-9-5-6-10-18(17)25(21)22(26)15-7-3-4-8-16(15)23(27)28/h3-13H,1-2H3,(H,27,28)/p-1 |
| InChIKey | CLUJMXFQLLSXMY-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 93.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |