C25H23ClN4O3S — CID 35859038
3-[(3-chlorophenyl)-methylsulfamoyl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 35859038) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 35859038 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 3-[(3-chlorophenyl)-methylsulfamoyl]-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CN(c1cccc(Cl)c1)S(=O)(=O)c1cccc(C(=O)NCc2ccc(Cn3ccnc3)cc2)c1 |
| InChI | InChI=1S/C25H23ClN4O3S/c1-29(23-6-3-5-22(26)15-23)34(32,33)24-7-2-4-21(14-24)25(31)28-16-19-8-10-20(11-9-19)17-30-13-12-27-18-30/h2-15,18H,16-17H2,1H3,(H,28,31) |
| InChIKey | KVJZWRHLUCZIEB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |