C19H22N2O6 — CID 3586387
N-(2,6-dimethoxy-3-pyridinyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide (PubChem CID 3586387) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-(2,6-dimethoxy-3-pyridinyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(2,6-dimethoxy-3-pyridinyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3586387 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-(2,6-dimethoxy-3-pyridinyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(OC)c(OC)c2OC)c(OC)n1 |
| InChI | InChI=1S/C19H22N2O6/c1-23-14-9-6-12(17(25-3)18(14)26-4)7-10-15(22)20-13-8-11-16(24-2)21-19(13)27-5/h6-11H,1-5H3,(H,20,22) |
| InChIKey | QKZRJHSHUYUCIO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|