C39H52ClFN2O5 — CID 3590328
1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea (PubChem CID 3590328) has the molecular formula C39H52ClFN2O5 and a molecular weight of 683.31 g/mol. Its IUPAC name is 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 3590328 |
| Molecular Formula | C39H52ClFN2O5 |
| Molecular Weight | 683.31 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(oxolan-2-ylmethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)N(CC1CCCO1)CC1(O)CCC2C34C=CC5(C=C3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C39H52ClFN2O5/c1-24(2)42-34(46)43(22-26-7-6-18-48-26)23-38(47)15-12-33-36(38,4)14-11-32-35(3)13-10-25(44)20-37(35)16-17-39(32,33)28(21-37)31(45)19-27-29(40)8-5-9-30(27)41/h5,8-9,16-17,21,24-26,32-33,44,47H,6-7,10-15,18-20,22-23H2,1-4H3,(H,42,46) |
| InChIKey | QYXDVJHWFMGBRP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.31 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|