C20H27N3O2 — CID 35939919
(5S)-3'-[[ethyl(2-methylprop-2-enyl)amino]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 35939919) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (5S)-3'-[[ethyl(2-methylprop-2-enyl)amino]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (5S)-3'-[[ethyl(2-methylprop-2-enyl)amino]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 35939919 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (5S)-3'-[[ethyl(2-methylprop-2-enyl)amino]methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | C=C(C)CN(CC)CN1C(=O)N[C@]2(CCCCc3ccccc32)C1=O |
| InChI | InChI=1S/C20H27N3O2/c1-4-22(13-15(2)3)14-23-18(24)20(21-19(23)25)12-8-7-10-16-9-5-6-11-17(16)20/h5-6,9,11H,2,4,7-8,10,12-14H2,1,3H3,(H,21,25)/t20-/m0/s1 |
| InChIKey | NQUFOOQGHMFPHC-FQEVSTJZSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|