C11H7N5O4S2 — CID 3597790
3-methyl-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 3597790) has the molecular formula C11H7N5O4S2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-methyl-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 3-methyl-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3597790 |
| Molecular Formula | C11H7N5O4S2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-methyl-N-(5-nitro-1,3-thiazol-2-yl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | Cc1csc2ncc(C(=O)Nc3ncc([N+](=O)[O-])s3)c(=O)n12 |
| InChI | InChI=1S/C11H7N5O4S2/c1-5-4-21-11-13-2-6(9(18)15(5)11)8(17)14-10-12-3-7(22-10)16(19)20/h2-4H,1H3,(H,12,14,17) |
| InChIKey | PBUSDXJSTWCFAG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|