C21H22N2O3S2 — CID 35990962
2-[(2,5-dimethylphenyl)sulfonylamino]-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 35990962) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 35990962 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccccc2C(=O)NCCc2cccs2)c1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-15-9-10-16(2)20(14-15)28(25,26)23-19-8-4-3-7-18(19)21(24)22-12-11-17-6-5-13-27-17/h3-10,13-14,23H,11-12H2,1-2H3,(H,22,24) |
| InChIKey | IGBOFKSGGJKQQN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |