C25H27N3O5S — CID 55959451
2-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-[(4-methoxybenzoyl)amino]ethyl]benzamide (PubChem CID 55959451) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-[(4-methoxybenzoyl)amino]ethyl]benzamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-[(4-methoxybenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55959451 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-[2-[(4-methoxybenzoyl)amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)c2ccccc2NS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-17-8-9-18(2)23(16-17)34(31,32)28-22-7-5-4-6-21(22)25(30)27-15-14-26-24(29)19-10-12-20(33-3)13-11-19/h4-13,16,28H,14-15H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | CNSJPLFGLPQXEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|