C21H21N3O3S — CID 35994898
N-[2-(2-methylphenyl)ethyl]-4-(pyridin-4-ylsulfamoyl)benzamide (PubChem CID 35994898) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)ethyl]-4-(pyridin-4-ylsulfamoyl)benzamide.
| Compound Name | N-[2-(2-methylphenyl)ethyl]-4-(pyridin-4-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35994898 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-[2-(2-methylphenyl)ethyl]-4-(pyridin-4-ylsulfamoyl)benzamide |
| SMILES | Cc1ccccc1CCNC(=O)c1ccc(S(=O)(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-16-4-2-3-5-17(16)10-15-23-21(25)18-6-8-20(9-7-18)28(26,27)24-19-11-13-22-14-12-19/h2-9,11-14H,10,15H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | SVTJNBAPGWWWQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |